About (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene
(2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 176545919) has the molecular formula C17H12Cl2
and a molecular weight of 287.19 g/mol. Its IUPAC name is (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene |
| PubChem CID | 176545919 |
| Molecular Formula | C17H12Cl2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | ClC1=C(c2ccccc2)C(c2ccccc2)=CC1Cl |
| InChI | InChI=1S/C17H12Cl2/c18-15-11-14(12-7-3-1-4-8-12)16(17(15)19)13-9-5-2-6-10-13/h1-11,15H |
| InChIKey | GKHZZRYIYTWKSG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene?
The IUPAC name of (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene (CID 176545919) is (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene.
What is the SMILES notation for (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene?
The canonical SMILES for (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene is ClC1=C(c2ccccc2)C(c2ccccc2)=CC1Cl.
What is the InChIKey of (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene?
The InChIKey is GKHZZRYIYTWKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2/c18-15-11-14(12-7-3-1-4-8-12)16(17(15)19)13-9-5-2-6-10-13/h1-11,15H.
What are the key properties of (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene?
(2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene has a molecular weight of 287.19 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichloro-5-phenylcyclopenta-1,4-dien-1-yl)benzene is sourced from PubChem (CID 176545919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).