About 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene
1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene (PubChem CID 176545927) has the molecular formula C14H11Cl
and a molecular weight of 214.69 g/mol. Its IUPAC name is 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene |
| PubChem CID | 176545927 |
| Molecular Formula | C14H11Cl |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene |
| SMILES | Clc1ccccc1C=C=CC1=CC=CC1 |
| InChI | InChI=1S/C14H11Cl/c15-14-11-4-3-9-13(14)10-5-8-12-6-1-2-7-12/h1-4,6,8-11H,7H2 |
| InChIKey | DODZUFCATUVLKF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene?
The IUPAC name of 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene (CID 176545927) is 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene.
What is the SMILES notation for 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene?
The canonical SMILES for 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene is Clc1ccccc1C=C=CC1=CC=CC1.
What is the InChIKey of 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene?
The InChIKey is DODZUFCATUVLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl/c15-14-11-4-3-9-13(14)10-5-8-12-6-1-2-7-12/h1-4,6,8-11H,7H2.
What are the key properties of 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene?
1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene has a molecular weight of 214.69 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(3-cyclopenta-1,3-dien-1-ylpropa-1,2-dienyl)benzene is sourced from PubChem (CID 176545927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).