C10H15F2N3 — CID 176546175
3-(1,1-difluoroethyl)-5-[dimethylamino(methyl)amino]cyclopenta-1,3,4-trien-1-amine (PubChem CID 176546175) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-[dimethylamino(methyl)amino]cyclopenta-1,3,4-trien-1-amine.
| Compound Name | 3-(1,1-difluoroethyl)-5-[dimethylamino(methyl)amino]cyclopenta-1,3,4-trien-1-amine |
|---|---|
| PubChem CID | 176546175 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-[dimethylamino(methyl)amino]cyclopenta-1,3,4-trien-1-amine |
| SMILES | CN(C)N(C)C1=C=C(C(C)(F)F)C=C1N |
| InChI | InChI=1S/C10H15F2N3/c1-10(11,12)7-5-8(13)9(6-7)15(4)14(2)3/h5H,13H2,1-4H3 |
| InChIKey | DGJDRKIHPMAHGV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|