C9H19N5O — CID 176546751
2-carbamimidoyl-1-ethyl-1-(oxolan-2-ylmethyl)guanidine (PubChem CID 176546751) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-carbamimidoyl-1-ethyl-1-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-carbamimidoyl-1-ethyl-1-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 176546751 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-carbamimidoyl-1-ethyl-1-(oxolan-2-ylmethyl)guanidine |
| SMILES | [H]/N=C(N)/N=C(\N)N(CC)CC1CCCO1 |
| InChI | InChI=1S/C9H19N5O/c1-2-14(9(12)13-8(10)11)6-7-4-3-5-15-7/h7H,2-6H2,1H3,(H5,10,11,12,13) |
| InChIKey | VZOCSZIVLZGBGO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|