C7H15F3N6 — CID 176547138
N-[N-amino-N-(3-aminopropyl)carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 176547138) has the molecular formula C7H15F3N6 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-[N-amino-N-(3-aminopropyl)carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-[N-amino-N-(3-aminopropyl)carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 176547138 |
| Molecular Formula | C7H15F3N6 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[N-amino-N-(3-aminopropyl)carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | [H]/N=C(/N/C(=N/C)C(F)(F)F)N(N)CCCN |
| InChI | InChI=1S/C7H15F3N6/c1-14-5(7(8,9)10)15-6(12)16(13)4-2-3-11/h2-4,11,13H2,1H3,(H2,12,14,15) |
| InChIKey | WQINIMDEBHQJEV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|