C8H17F3N6 — CID 176547139
N-[N-amino-N-[3-(methylamino)propyl]carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 176547139) has the molecular formula C8H17F3N6 and a molecular weight of 254.26 g/mol. Its IUPAC name is N-[N-amino-N-[3-(methylamino)propyl]carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-[N-amino-N-[3-(methylamino)propyl]carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 176547139 |
| Molecular Formula | C8H17F3N6 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[N-amino-N-[3-(methylamino)propyl]carbamimidoyl]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | [H]/N=C(/N/C(=N/C)C(F)(F)F)N(N)CCCNC |
| InChI | InChI=1S/C8H17F3N6/c1-14-4-3-5-17(13)7(12)16-6(15-2)8(9,10)11/h14H,3-5,13H2,1-2H3,(H2,12,15,16) |
| InChIKey | PUCDPYOOISPLJD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|