C10H15N3 — CID 176547519
2,6-dimethyl-4-[(3Z)-penta-1,3-dien-2-yl]-1,2-dihydro-1,3,5-triazine (PubChem CID 176547519) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(3Z)-penta-1,3-dien-2-yl]-1,2-dihydro-1,3,5-triazine.
| Compound Name | 2,6-dimethyl-4-[(3Z)-penta-1,3-dien-2-yl]-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 176547519 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2,6-dimethyl-4-[(3Z)-penta-1,3-dien-2-yl]-1,2-dihydro-1,3,5-triazine |
| SMILES | C=C(/C=C\C)C1=NC(C)NC(C)=N1 |
| InChI | InChI=1S/C10H15N3/c1-5-6-7(2)10-12-8(3)11-9(4)13-10/h5-6,8H,2H2,1,3-4H3,(H,11,12,13)/b6-5- |
| InChIKey | JCVSDHSEPTUOCC-WAYWQWQTSA-N |
| XLogP | 1.88 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|