C7H11N3 — CID 176548006
2,6-dimethyl-1,2-dihydro-1,4-diazepin-7-imine (PubChem CID 176548006) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,6-dimethyl-1,2-dihydro-1,4-diazepin-7-imine.
| Compound Name | 2,6-dimethyl-1,2-dihydro-1,4-diazepin-7-imine |
|---|---|
| PubChem CID | 176548006 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2,6-dimethyl-1,2-dihydro-1,4-diazepin-7-imine |
| SMILES | [H]/N=C1\NC(C)C=NC=C1C |
| InChI | InChI=1S/C7H11N3/c1-5-3-9-4-6(2)10-7(5)8/h3-4,6H,1-2H3,(H2,8,10) |
| InChIKey | GPEQXBCPWPJONW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|