About N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine
N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine (PubChem CID 176548583) has the molecular formula C20H24ClN3
and a molecular weight of 341.89 g/mol. Its IUPAC name is N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine |
| PubChem CID | 176548583 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine |
| SMILES | CCCCN(CCCC)c1ccc2ccc3ccc(Cl)nc3c2n1 |
| InChI | InChI=1S/C20H24ClN3/c1-3-5-13-24(14-6-4-2)18-12-10-16-8-7-15-9-11-17(21)22-19(15)20(16)23-18/h7-12H,3-6,13-14H2,1-2H3 |
| InChIKey | ZTZNMNGMKWVIIU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine?
The IUPAC name of N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine (CID 176548583) is N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine.
What is the SMILES notation for N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine?
The canonical SMILES for N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine is CCCCN(CCCC)c1ccc2ccc3ccc(Cl)nc3c2n1.
What is the InChIKey of N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine?
The InChIKey is ZTZNMNGMKWVIIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClN3/c1-3-5-13-24(14-6-4-2)18-12-10-16-8-7-15-9-11-17(21)22-19(15)20(16)23-18/h7-12H,3-6,13-14H2,1-2H3.
What are the key properties of N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine?
N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine has a molecular weight of 341.89 g/mol, XLogP of 5.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-9-chloro-1,10-phenanthrolin-2-amine is sourced from PubChem (CID 176548583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).