About 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline
2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline (PubChem CID 176549511) has the molecular formula C18H13F3N2O2
and a molecular weight of 346.31 g/mol. Its IUPAC name is 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline.
Molecular Properties
| Compound Name | 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline |
| PubChem CID | 176549511 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline |
| SMILES | COc1cc2cc(C(F)(F)F)n3nc4ccccc4c3c2cc1OC |
| InChI | InChI=1S/C18H13F3N2O2/c1-24-14-7-10-8-16(18(19,20)21)23-17(12(10)9-15(14)25-2)11-5-3-4-6-13(11)22-23/h3-9H,1-2H3 |
| InChIKey | IVNBAPNYJLFLAW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline?
The IUPAC name of 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline (CID 176549511) is 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline.
What is the SMILES notation for 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline?
The canonical SMILES for 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline is COc1cc2cc(C(F)(F)F)n3nc4ccccc4c3c2cc1OC.
What is the InChIKey of 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline?
The InChIKey is IVNBAPNYJLFLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O2/c1-24-14-7-10-8-16(18(19,20)21)23-17(12(10)9-15(14)25-2)11-5-3-4-6-13(11)22-23/h3-9H,1-2H3.
What are the key properties of 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline?
2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline has a molecular weight of 346.31 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-6-(trifluoromethyl)indazolo[3,2-a]isoquinoline is sourced from PubChem (CID 176549511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).