C20H12F3NO4 — CID 176549908
(E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2,2,2-trifluoroacetyl)-1H-indol-7-yl]prop-2-en-1-one (PubChem CID 176549908) has the molecular formula C20H12F3NO4 and a molecular weight of 387.31 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2,2,2-trifluoroacetyl)-1H-indol-7-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2,2,2-trifluoroacetyl)-1H-indol-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176549908 |
| Molecular Formula | C20H12F3NO4 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2,2,2-trifluoroacetyl)-1H-indol-7-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2c(C(=O)C(F)(F)F)c[nH]c12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H12F3NO4/c21-20(22,23)19(26)14-9-24-18-11(2-1-3-13(14)18)4-6-15(25)12-5-7-16-17(8-12)28-10-27-16/h1-9,24H,10H2/b6-4+ |
| InChIKey | WSVYLBUDQWNELF-GQCTYLIASA-N |
| XLogP | 4.54 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|