About 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine
2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine (PubChem CID 176550079) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine |
| PubChem CID | 176550079 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine |
| SMILES | C1=COC(c2cccc(C3CCCCC3)n2)O1 |
| InChI | InChI=1S/C14H17NO2/c1-2-5-11(6-3-1)12-7-4-8-13(15-12)14-16-9-10-17-14/h4,7-11,14H,1-3,5-6H2 |
| InChIKey | VPYNTKGLGBSXSG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine?
The IUPAC name of 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine (CID 176550079) is 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine.
What is the SMILES notation for 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine?
The canonical SMILES for 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine is C1=COC(c2cccc(C3CCCCC3)n2)O1.
What is the InChIKey of 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine?
The InChIKey is VPYNTKGLGBSXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-2-5-11(6-3-1)12-7-4-8-13(15-12)14-16-9-10-17-14/h4,7-11,14H,1-3,5-6H2.
What are the key properties of 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine?
2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine has a molecular weight of 231.30 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6-(1,3-dioxol-2-yl)pyridine is sourced from PubChem (CID 176550079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).