About 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline
2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline (PubChem CID 176550181) has the molecular formula C9H11F4NOS
and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline.
Molecular Properties
| Compound Name | 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline |
| PubChem CID | 176550181 |
| Molecular Formula | C9H11F4NOS |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline |
| SMILES | CS(=O)(F)(CC(F)(F)F)c1ccccc1N |
| InChI | InChI=1S/C9H11F4NOS/c1-16(13,15,6-9(10,11)12)8-5-3-2-4-7(8)14/h2-5H,6,14H2,1H3 |
| InChIKey | YCLIRHNHUJDOCR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline?
The IUPAC name of 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline (CID 176550181) is 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline.
What is the SMILES notation for 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline?
The canonical SMILES for 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline is CS(=O)(F)(CC(F)(F)F)c1ccccc1N.
What is the InChIKey of 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline?
The InChIKey is YCLIRHNHUJDOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F4NOS/c1-16(13,15,6-9(10,11)12)8-5-3-2-4-7(8)14/h2-5H,6,14H2,1H3.
What are the key properties of 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline?
2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline has a molecular weight of 257.25 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[fluoro-methyl-oxo-(2,2,2-trifluoroethyl)-λ6-sulfanyl]aniline is sourced from PubChem (CID 176550181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).