C18H28O3 — CID 176550249
[(E)-6,7,7-trimethyloct-5-en-2-yl] 4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 176550249) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [(E)-6,7,7-trimethyloct-5-en-2-yl] 4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | [(E)-6,7,7-trimethyloct-5-en-2-yl] 4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 176550249 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [(E)-6,7,7-trimethyloct-5-en-2-yl] 4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | C/C(=C\CCC(C)OC(=O)C1C=CC(=O)CC1)C(C)(C)C |
| InChI | InChI=1S/C18H28O3/c1-13(18(3,4)5)7-6-8-14(2)21-17(20)15-9-11-16(19)12-10-15/h7,9,11,14-15H,6,8,10,12H2,1-5H3/b13-7+ |
| InChIKey | YVZGDGPSOLUAJP-NTUHNPAUSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|