About [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene)
[(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) (PubChem CID 176550862) has the molecular formula C17H23FeNO-2
and a molecular weight of 313.22 g/mol. Its IUPAC name is [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene).
Molecular Properties
| Compound Name | [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) |
| PubChem CID | 176550862 |
| Molecular Formula | C17H23FeNO-2 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) |
| SMILES | CC(C)(C)[C@@H]1CNC(=[Fe])O1.c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C7H13NO.2C5H5.Fe/c1-7(2,3)6-4-8-5-9-6;2*1-2-4-5-3-1;/h6,8H,4H2,1-3H3;2*1-5H;/q;2*-1;/t6-;;;/m0.../s1 |
| InChIKey | UCTREANINUQJAJ-GSUNZCPGSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene)?
The IUPAC name of [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) (CID 176550862) is [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene).
What is the SMILES notation for [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene)?
The canonical SMILES for [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) is CC(C)(C)[C@@H]1CNC(=[Fe])O1.c1cc[cH-]c1.c1cc[cH-]c1.
What is the InChIKey of [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene)?
The InChIKey is UCTREANINUQJAJ-GSUNZCPGSA-N. The full InChI is InChI=1S/C7H13NO.2C5H5.Fe/c1-7(2,3)6-4-8-5-9-6;2*1-2-4-5-3-1;/h6,8H,4H2,1-3H3;2*1-5H;/q;2*-1;/t6-;;;/m0.../s1.
What are the key properties of [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene)?
[(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) has a molecular weight of 313.22 g/mol, XLogP of 3.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-tert-butyl-1,3-oxazolidin-2-ylidene]iron;bis(cyclopenta-1,3-diene) is sourced from PubChem (CID 176550862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).