C26H26F2N6OS — CID 176550992
1-[6-amino-8-[2-(2-cyclopropyl-4,6-difluoro-1,3-benzothiazol-5-yl)ethyl]-13,13-dimethyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-11-yl]prop-2-en-1-one (PubChem CID 176550992) has the molecular formula C26H26F2N6OS and a molecular weight of 508.60 g/mol. Its IUPAC name is 1-[6-amino-8-[2-(2-cyclopropyl-4,6-difluoro-1,3-benzothiazol-5-yl)ethyl]-13,13-dimethyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-11-yl]prop-2-en-1-one.
| Compound Name | 1-[6-amino-8-[2-(2-cyclopropyl-4,6-difluoro-1,3-benzothiazol-5-yl)ethyl]-13,13-dimethyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-11-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176550992 |
| Molecular Formula | C26H26F2N6OS |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-[6-amino-8-[2-(2-cyclopropyl-4,6-difluoro-1,3-benzothiazol-5-yl)ethyl]-13,13-dimethyl-1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-11-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2c(CCc3c(F)cc4sc(C5CC5)nc4c3F)c3c(N)ncnc3n2C(C)(C)C1 |
| InChI | InChI=1S/C26H26F2N6OS/c1-4-19(35)33-10-17-15(20-23(29)30-12-31-24(20)34(17)26(2,3)11-33)8-7-14-16(27)9-18-22(21(14)28)32-25(36-18)13-5-6-13/h4,9,12-13H,1,5-8,10-11H2,2-3H3,(H2,29,30,31) |
| InChIKey | AYZPOWKOOOTGAV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|