About [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate
[dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 176551410) has the molecular formula C16H17F3O3S2
and a molecular weight of 378.44 g/mol. Its IUPAC name is [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| PubChem CID | 176551410 |
| Molecular Formula | C16H17F3O3S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(C)(Cc1ccc(-c2ccccc2)cc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O3S2/c1-23(2,22-24(20,21)16(17,18)19)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | IETUFWBERLPOSR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate?
The IUPAC name of [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate (CID 176551410) is [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate?
The canonical SMILES for [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate is CS(C)(Cc1ccc(-c2ccccc2)cc1)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate?
The InChIKey is IETUFWBERLPOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3O3S2/c1-23(2,22-24(20,21)16(17,18)19)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3.
What are the key properties of [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate?
[dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate has a molecular weight of 378.44 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-[(4-phenylphenyl)methyl]-λ4-sulfanyl] trifluoromethanesulfonate is sourced from PubChem (CID 176551410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).