C13H15ClFNO2S — CID 176551664
(4aR,7aR)-6-(4-chloro-3-fluorophenyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide (PubChem CID 176551664) has the molecular formula C13H15ClFNO2S and a molecular weight of 303.79 g/mol. Its IUPAC name is (4aR,7aR)-6-(4-chloro-3-fluorophenyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (4aR,7aR)-6-(4-chloro-3-fluorophenyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 176551664 |
| Molecular Formula | C13H15ClFNO2S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (4aR,7aR)-6-(4-chloro-3-fluorophenyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole 1,1-dioxide |
| SMILES | O=S1(=O)CCC[C@@H]2CN(c3ccc(Cl)c(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C13H15ClFNO2S/c14-11-4-3-10(6-12(11)15)16-7-9-2-1-5-19(17,18)13(9)8-16/h3-4,6,9,13H,1-2,5,7-8H2/t9-,13+/m1/s1 |
| InChIKey | YAGRNSQHJVJBTO-RNCFNFMXSA-N |
| XLogP | 2.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |