About 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine
4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine (PubChem CID 176552593) has the molecular formula C15H22F3N
and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine.
Molecular Properties
| Compound Name | 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine |
| PubChem CID | 176552593 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C(=C(\C=C)C(F)(F)F)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H22F3N/c1-5-13(15(16,17)18)14(6-2)19-9-7-12(8-10-19)11(3)4/h5-6,11-12H,1-2,7-10H2,3-4H3/b14-13- |
| InChIKey | UHEGZKSPTFBZTK-YPKPFQOOSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine?
The IUPAC name of 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine (CID 176552593) is 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine.
What is the SMILES notation for 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine?
The canonical SMILES for 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine is C=C/C(=C(\C=C)C(F)(F)F)N1CCC(C(C)C)CC1.
What is the InChIKey of 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine?
The InChIKey is UHEGZKSPTFBZTK-YPKPFQOOSA-N. The full InChI is InChI=1S/C15H22F3N/c1-5-13(15(16,17)18)14(6-2)19-9-7-12(8-10-19)11(3)4/h5-6,11-12H,1-2,7-10H2,3-4H3/b14-13-.
What are the key properties of 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine?
4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine has a molecular weight of 273.34 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1-[(3Z)-4-(trifluoromethyl)hexa-1,3,5-trien-3-yl]piperidine is sourced from PubChem (CID 176552593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).