C13H19F2N — CID 176552929
N-[(1E)-2-(difluoromethyl)-1-(4-methylcyclohexyl)buta-1,3-dienyl]methanimine (PubChem CID 176552929) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[(1E)-2-(difluoromethyl)-1-(4-methylcyclohexyl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E)-2-(difluoromethyl)-1-(4-methylcyclohexyl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 176552929 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[(1E)-2-(difluoromethyl)-1-(4-methylcyclohexyl)buta-1,3-dienyl]methanimine |
| SMILES | C=C/C(=C(\N=C)C1CCC(C)CC1)C(F)F |
| InChI | InChI=1S/C13H19F2N/c1-4-11(13(14)15)12(16-3)10-7-5-9(2)6-8-10/h4,9-10,13H,1,3,5-8H2,2H3/b12-11+ |
| InChIKey | MYGTUYXUHHXFEU-VAWYXSNFSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|