C28H29N3O2 — CID 176553228
4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-1H-pyrazolo[3,4-b]pyridine;methylcyclopropane;methyl formate (PubChem CID 176553228) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-1H-pyrazolo[3,4-b]pyridine;methylcyclopropane;methyl formate.
| Compound Name | 4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-1H-pyrazolo[3,4-b]pyridine;methylcyclopropane;methyl formate |
|---|---|
| PubChem CID | 176553228 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-1H-pyrazolo[3,4-b]pyridine;methylcyclopropane;methyl formate |
| SMILES | C(/C=C/c1ccnc2[nH]ncc12)=C(c1ccccc1)c1ccccc1.CC1CC1.COC=O |
| InChI | InChI=1S/C22H17N3.C4H8.C2H4O2/c1-3-8-17(9-4-1)20(18-10-5-2-6-11-18)13-7-12-19-14-15-23-22-21(19)16-24-25-22;1-4-2-3-4;1-4-2-3/h1-16H,(H,23,24,25);4H,2-3H2,1H3;2H,1H3/b12-7+;; |
| InChIKey | HYUZNMFQFXGXND-CURPJKDSSA-N |
| XLogP | 6.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|