About N,N'-dimethylethanimidamide;ethane
N,N'-dimethylethanimidamide;ethane (PubChem CID 176553571) has the molecular formula C6H16N2
and a molecular weight of 116.21 g/mol. Its IUPAC name is N,N'-dimethylethanimidamide;ethane.
Molecular Properties
| Compound Name | N,N'-dimethylethanimidamide;ethane |
| PubChem CID | 176553571 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | N,N'-dimethylethanimidamide;ethane |
| SMILES | C/N=C(\C)NC.CC |
| InChI | InChI=1S/C4H10N2.C2H6/c1-4(5-2)6-3;1-2/h1-3H3,(H,5,6);1-2H3 |
| InChIKey | QUHXBXABDNMISY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethylethanimidamide;ethane?
The IUPAC name of N,N'-dimethylethanimidamide;ethane (CID 176553571) is N,N'-dimethylethanimidamide;ethane.
What is the SMILES notation for N,N'-dimethylethanimidamide;ethane?
The canonical SMILES for N,N'-dimethylethanimidamide;ethane is C/N=C(\C)NC.CC.
What is the InChIKey of N,N'-dimethylethanimidamide;ethane?
The InChIKey is QUHXBXABDNMISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.C2H6/c1-4(5-2)6-3;1-2/h1-3H3,(H,5,6);1-2H3.
What are the key properties of N,N'-dimethylethanimidamide;ethane?
N,N'-dimethylethanimidamide;ethane has a molecular weight of 116.21 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethylethanimidamide;ethane is sourced from PubChem (CID 176553571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).