C6H16N2 — CID 176553571
N,N'-dimethylethanimidamide;ethane (PubChem CID 176553571) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is N,N'-dimethylethanimidamide;ethane.
| Compound Name | N,N'-dimethylethanimidamide;ethane |
|---|---|
| PubChem CID | 176553571 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | N,N'-dimethylethanimidamide;ethane |
| SMILES | C/N=C(\C)NC.CC |
| InChI | InChI=1S/C4H10N2.C2H6/c1-4(5-2)6-3;1-2/h1-3H3,(H,5,6);1-2H3 |
| InChIKey | QUHXBXABDNMISY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|