About N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane
N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane (PubChem CID 176553610) has the molecular formula C16H19F3N2O2
and a molecular weight of 328.33 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane |
| PubChem CID | 176553610 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane |
| SMILES | CC.O=C(Cn1cc(C(F)(F)F)ccc1=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C14H13F3N2O2.C2H6/c15-14(16,17)10-6-7-13(21)19(8-10)9-12(20)18-11-4-2-1-3-5-11;1-2/h2,4-8H,1,3,9H2,(H,18,20);1-2H3 |
| InChIKey | IOOHWFKLRVYSIJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane (CID 176553610) is N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane is CC.O=C(Cn1cc(C(F)(F)F)ccc1=O)NC1=CCCC=C1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane?
The InChIKey is IOOHWFKLRVYSIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2O2.C2H6/c15-14(16,17)10-6-7-13(21)19(8-10)9-12(20)18-11-4-2-1-3-5-11;1-2/h2,4-8H,1,3,9H2,(H,18,20);1-2H3.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane?
N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane has a molecular weight of 328.33 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide;ethane is sourced from PubChem (CID 176553610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).