About 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine
2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine (PubChem CID 176553625) has the molecular formula C27H36N2
and a molecular weight of 388.60 g/mol. Its IUPAC name is 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine.
Molecular Properties
| Compound Name | 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine |
| PubChem CID | 176553625 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine |
| SMILES | C=C(C)CCCC.C=C(NCCCC)c1cn(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H22N2.C7H14/c1-3-4-14-21-16(2)19-15-22(17-10-6-5-7-11-17)20-13-9-8-12-18(19)20;1-4-5-6-7(2)3/h5-13,15,21H,2-4,14H2,1H3;2,4-6H2,1,3H3 |
| InChIKey | CLOJSAFPNYECIZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine?
The IUPAC name of 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine (CID 176553625) is 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine.
What is the SMILES notation for 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine?
The canonical SMILES for 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine is C=C(C)CCCC.C=C(NCCCC)c1cn(-c2ccccc2)c2ccccc12.
What is the InChIKey of 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine?
The InChIKey is CLOJSAFPNYECIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2.C7H14/c1-3-4-14-21-16(2)19-15-22(17-10-6-5-7-11-17)20-13-9-8-12-18(19)20;1-4-5-6-7(2)3/h5-13,15,21H,2-4,14H2,1H3;2,4-6H2,1,3H3.
What are the key properties of 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine?
2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine has a molecular weight of 388.60 g/mol, XLogP of 7.74, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-1-ene;N-[1-(1-phenylindol-3-yl)ethenyl]butan-1-amine is sourced from PubChem (CID 176553625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).