C26H24N2O3 — CID 176554954
4-(8-hydroxyquinolin-6-yl)-3-methoxy-N-(3-phenylpropyl)benzamide (PubChem CID 176554954) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(8-hydroxyquinolin-6-yl)-3-methoxy-N-(3-phenylpropyl)benzamide.
| Compound Name | 4-(8-hydroxyquinolin-6-yl)-3-methoxy-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 176554954 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-(8-hydroxyquinolin-6-yl)-3-methoxy-N-(3-phenylpropyl)benzamide |
| SMILES | COc1cc(C(=O)NCCCc2ccccc2)ccc1-c1cc(O)c2ncccc2c1 |
| InChI | InChI=1S/C26H24N2O3/c1-31-24-17-20(26(30)28-14-5-9-18-7-3-2-4-8-18)11-12-22(24)21-15-19-10-6-13-27-25(19)23(29)16-21/h2-4,6-8,10-13,15-17,29H,5,9,14H2,1H3,(H,28,30) |
| InChIKey | JEMPVNUEXLESQX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|