C24H23ClN4O2S2 — CID 176555684
N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide;ethane (PubChem CID 176555684) has the molecular formula C24H23ClN4O2S2 and a molecular weight of 499.06 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide;ethane.
| Compound Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 176555684 |
| Molecular Formula | C24H23ClN4O2S2 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide;ethane |
| SMILES | CC.COc1ccccc1-c1cnccc1C(=O)Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H17ClN4O2S2.C2H6/c1-29-19-5-3-2-4-16(19)18-12-24-11-10-17(18)20(28)25-21-26-27-22(31-21)30-13-14-6-8-15(23)9-7-14;1-2/h2-12H,13H2,1H3,(H,25,26,28);1-2H3 |
| InChIKey | KKQSTGJEEDEWNN-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|