About 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate
5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate (PubChem CID 176555808) has the molecular formula C18H26N2O5
and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate.
Molecular Properties
| Compound Name | 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate |
| PubChem CID | 176555808 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate |
| SMILES | C=C=C1C=CC(=O)N1CCCCCC.CN(OC=O)C(=O)CCC=O |
| InChI | InChI=1S/C12H17NO.C6H9NO4/c1-3-5-6-7-10-13-11(4-2)8-9-12(13)14;1-7(11-5-9)6(10)3-2-4-8/h8-9H,2-3,5-7,10H2,1H3;4-5H,2-3H2,1H3 |
| InChIKey | JSMTXCKUVCKJHI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate?
The IUPAC name of 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate (CID 176555808) is 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate.
What is the SMILES notation for 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate?
The canonical SMILES for 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate is C=C=C1C=CC(=O)N1CCCCCC.CN(OC=O)C(=O)CCC=O.
What is the InChIKey of 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate?
The InChIKey is JSMTXCKUVCKJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C6H9NO4/c1-3-5-6-7-10-13-11(4-2)8-9-12(13)14;1-7(11-5-9)6(10)3-2-4-8/h8-9H,2-3,5-7,10H2,1H3;4-5H,2-3H2,1H3.
What are the key properties of 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate?
5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate has a molecular weight of 350.42 g/mol, XLogP of 2.15, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylidene-1-hexylpyrrol-2-one;[methyl(4-oxobutanoyl)amino] formate is sourced from PubChem (CID 176555808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).