About 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane
5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane (PubChem CID 176555821) has the molecular formula C13H30N2O4
and a molecular weight of 278.39 g/mol. Its IUPAC name is 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane.
Molecular Properties
| Compound Name | 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane |
| PubChem CID | 176555821 |
| Molecular Formula | C13H30N2O4 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane |
| SMILES | CC(=O)CCCOCCOCCN.CCC.NC=O |
| InChI | InChI=1S/C9H19NO3.C3H8.CH3NO/c1-9(11)3-2-5-12-7-8-13-6-4-10;1-3-2;2-1-3/h2-8,10H2,1H3;3H2,1-2H3;1H,(H2,2,3) |
| InChIKey | GMYDBRPBMNIOMQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane?
The IUPAC name of 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane (CID 176555821) is 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane.
What is the SMILES notation for 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane?
The canonical SMILES for 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane is CC(=O)CCCOCCOCCN.CCC.NC=O.
What is the InChIKey of 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane?
The InChIKey is GMYDBRPBMNIOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3.C3H8.CH3NO/c1-9(11)3-2-5-12-7-8-13-6-4-10;1-3-2;2-1-3/h2-8,10H2,1H3;3H2,1-2H3;1H,(H2,2,3).
What are the key properties of 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane?
5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane has a molecular weight of 278.39 g/mol, XLogP of 0.87, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-aminoethoxy)ethoxy]pentan-2-one;formamide;propane is sourced from PubChem (CID 176555821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).