C44H40N8OS — CID 176556169
ethane;2-[4-(furan-2-ylmethyl)-5-(2-phenylethynyl)-1,2,4-triazol-3-yl]pyridine;2-[5-(1,2,3,4-tetrahydronaphthalen-2-yl)-4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 176556169) has the molecular formula C44H40N8OS and a molecular weight of 728.93 g/mol. Its IUPAC name is ethane;2-[4-(furan-2-ylmethyl)-5-(2-phenylethynyl)-1,2,4-triazol-3-yl]pyridine;2-[5-(1,2,3,4-tetrahydronaphthalen-2-yl)-4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | ethane;2-[4-(furan-2-ylmethyl)-5-(2-phenylethynyl)-1,2,4-triazol-3-yl]pyridine;2-[5-(1,2,3,4-tetrahydronaphthalen-2-yl)-4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 176556169 |
| Molecular Formula | C44H40N8OS |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | ethane;2-[4-(furan-2-ylmethyl)-5-(2-phenylethynyl)-1,2,4-triazol-3-yl]pyridine;2-[5-(1,2,3,4-tetrahydronaphthalen-2-yl)-4-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | C(#Cc1nnc(-c2ccccn2)n1Cc1ccco1)c1ccccc1.CC.c1ccc(-c2nnc(C3CCc4ccccc4C3)n2Cc2cccs2)nc1 |
| InChI | InChI=1S/C22H20N4S.C20H14N4O.C2H6/c1-2-7-17-14-18(11-10-16(17)6-1)21-24-25-22(20-9-3-4-12-23-20)26(21)15-19-8-5-13-27-19;1-2-7-16(8-3-1)11-12-19-22-23-20(18-10-4-5-13-21-18)24(19)15-17-9-6-14-25-17;1-2/h1-9,12-13,18H,10-11,14-15H2;1-10,13-14H,15H2;1-2H3 |
| InChIKey | HXZBRHJPXOUKMS-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|