C11H20N4O — CID 176556421
(Z,Z)-N-[[2-(methoxymethyl)piperazin-1-yl]methyl]-N'-methylideneprop-2-ene-1,3-diimine (PubChem CID 176556421) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is (Z,Z)-N-[[2-(methoxymethyl)piperazin-1-yl]methyl]-N'-methylideneprop-2-ene-1,3-diimine.
| Compound Name | (Z,Z)-N-[[2-(methoxymethyl)piperazin-1-yl]methyl]-N'-methylideneprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 176556421 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (Z,Z)-N-[[2-(methoxymethyl)piperazin-1-yl]methyl]-N'-methylideneprop-2-ene-1,3-diimine |
| SMILES | C=N/C=C\C=N/CN1CCNCC1COC |
| InChI | InChI=1S/C11H20N4O/c1-12-4-3-5-14-10-15-7-6-13-8-11(15)9-16-2/h3-5,11,13H,1,6-10H2,2H3/b4-3-,14-5- |
| InChIKey | KOECZGXFSKJQBL-KHCPYNEOSA-N |
| XLogP | 0.15 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|