C31H22N2O8 — CID 176556750
methyl 2-[5-formyl-7-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaen-16-yl]acetate (PubChem CID 176556750) has the molecular formula C31H22N2O8 and a molecular weight of 550.52 g/mol. Its IUPAC name is methyl 2-[5-formyl-7-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaen-16-yl]acetate.
| Compound Name | methyl 2-[5-formyl-7-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaen-16-yl]acetate |
|---|---|
| PubChem CID | 176556750 |
| Molecular Formula | C31H22N2O8 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | methyl 2-[5-formyl-7-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2(23),3,5,7,9,11,13,18(22),19-decaen-16-yl]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1ccc2c3ccc4c5c(ccc(c6ccc(C=O)c1c62)c53)C(=O)N(CC(=O)OC)C4=O |
| InChI | InChI=1S/C31H22N2O8/c1-32(12-23(35)40-2)29(37)20-9-6-17-19-8-11-22-28-21(30(38)33(31(22)39)13-24(36)41-3)10-7-18(27(19)28)16-5-4-15(14-34)25(20)26(16)17/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | MARRQGVZZINVBH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|