C9H8F5NO — CID 176556839
1,1,1,3,4-pentafluoro-3-pyridin-2-ylbutan-2-ol (PubChem CID 176556839) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 1,1,1,3,4-pentafluoro-3-pyridin-2-ylbutan-2-ol.
| Compound Name | 1,1,1,3,4-pentafluoro-3-pyridin-2-ylbutan-2-ol |
|---|---|
| PubChem CID | 176556839 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1,1,1,3,4-pentafluoro-3-pyridin-2-ylbutan-2-ol |
| SMILES | OC(C(F)(F)F)C(F)(CF)c1ccccn1 |
| InChI | InChI=1S/C9H8F5NO/c10-5-8(11,7(16)9(12,13)14)6-3-1-2-4-15-6/h1-4,7,16H,5H2 |
| InChIKey | STEVJRCCMIGUDC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |