About 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane
6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane (PubChem CID 176556891) has the molecular formula C14H23N2+
and a molecular weight of 219.35 g/mol. Its IUPAC name is 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane.
Molecular Properties
| Compound Name | 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane |
| PubChem CID | 176556891 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane |
| SMILES | CC.C[N+]1(C)CC=CC=C1C1=CC=CCN1 |
| InChI | InChI=1S/C12H17N2.C2H6/c1-14(2)10-6-4-8-12(14)11-7-3-5-9-13-11;1-2/h3-8,13H,9-10H2,1-2H3;1-2H3/q+1; |
| InChIKey | NGHWWILCSPKISB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane?
The IUPAC name of 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane (CID 176556891) is 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane.
What is the SMILES notation for 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane?
The canonical SMILES for 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane is CC.C[N+]1(C)CC=CC=C1C1=CC=CCN1.
What is the InChIKey of 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane?
The InChIKey is NGHWWILCSPKISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N2.C2H6/c1-14(2)10-6-4-8-12(14)11-7-3-5-9-13-11;1-2/h3-8,13H,9-10H2,1-2H3;1-2H3/q+1;.
What are the key properties of 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane?
6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane has a molecular weight of 219.35 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2-dihydropyridin-6-yl)-1,1-dimethyl-2H-pyridin-1-ium;ethane is sourced from PubChem (CID 176556891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).