C27H33ClN2O5 — CID 176557936
[1-[4-[2-[[(3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-2,3-dihydro-1H-benzimidazol-5-yl]phenyl]cyclopropyl]methanol (PubChem CID 176557936) has the molecular formula C27H33ClN2O5 and a molecular weight of 501.02 g/mol. Its IUPAC name is [1-[4-[2-[[(3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-2,3-dihydro-1H-benzimidazol-5-yl]phenyl]cyclopropyl]methanol.
| Compound Name | [1-[4-[2-[[(3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-2,3-dihydro-1H-benzimidazol-5-yl]phenyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 176557936 |
| Molecular Formula | C27H33ClN2O5 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | [1-[4-[2-[[(3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-2,3-dihydro-1H-benzimidazol-5-yl]phenyl]cyclopropyl]methanol |
| SMILES | CCCCOC1CO[C@H]2[C@@H]1OC[C@H]2OC1Nc2cc(Cl)c(-c3ccc(C4(CO)CC4)cc3)cc2N1 |
| InChI | InChI=1S/C27H33ClN2O5/c1-2-3-10-32-22-13-33-25-23(14-34-24(22)25)35-26-29-20-11-18(19(28)12-21(20)30-26)16-4-6-17(7-5-16)27(15-31)8-9-27/h4-7,11-12,22-26,29-31H,2-3,8-10,13-15H2,1H3/t22?,23-,24-,25-,26?/m1/s1 |
| InChIKey | RHJSQLNYXICTSX-KXHWFKONSA-N |
| XLogP | 4.52 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|