C14H27F2NO — CID 176558045
2-(4-ethoxycyclohexyl)-N,N-diethyl-2,2-difluoroethanamine (PubChem CID 176558045) has the molecular formula C14H27F2NO and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-(4-ethoxycyclohexyl)-N,N-diethyl-2,2-difluoroethanamine.
| Compound Name | 2-(4-ethoxycyclohexyl)-N,N-diethyl-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 176558045 |
| Molecular Formula | C14H27F2NO |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 2-(4-ethoxycyclohexyl)-N,N-diethyl-2,2-difluoroethanamine |
| SMILES | CCOC1CCC(C(F)(F)CN(CC)CC)CC1 |
| InChI | InChI=1S/C14H27F2NO/c1-4-17(5-2)11-14(15,16)12-7-9-13(10-8-12)18-6-3/h12-13H,4-11H2,1-3H3 |
| InChIKey | FBHGKNYQMYPKLT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |