C21H29ClF2N4O3 — CID 176558054
4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzaldehyde;5,5-difluoro-7-methyl-2,7-diazaspiro[3.5]nonane;ethane (PubChem CID 176558054) has the molecular formula C21H29ClF2N4O3 and a molecular weight of 458.94 g/mol. Its IUPAC name is 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzaldehyde;5,5-difluoro-7-methyl-2,7-diazaspiro[3.5]nonane;ethane.
| Compound Name | 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzaldehyde;5,5-difluoro-7-methyl-2,7-diazaspiro[3.5]nonane;ethane |
|---|---|
| PubChem CID | 176558054 |
| Molecular Formula | C21H29ClF2N4O3 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzaldehyde;5,5-difluoro-7-methyl-2,7-diazaspiro[3.5]nonane;ethane |
| SMILES | CC.CN1CCC2(CNC2)C(F)(F)C1.O=Cc1ccc(Cl)c(N2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H9ClN2O3.C8H14F2N2.C2H6/c12-8-2-1-7(6-15)5-9(8)14-4-3-10(16)13-11(14)17;1-12-3-2-7(4-11-5-7)8(9,10)6-12;1-2/h1-2,5-6H,3-4H2,(H,13,16,17);11H,2-6H2,1H3;1-2H3 |
| InChIKey | JRYVUBZXIUTVCB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|