About ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane
ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane (PubChem CID 176558189) has the molecular formula C15H30F2N2
and a molecular weight of 276.41 g/mol. Its IUPAC name is ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane |
| PubChem CID | 176558189 |
| Molecular Formula | C15H30F2N2 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane |
| SMILES | CC.CCN1CCC2(CC1)CN(C(C)C)CC2(F)F |
| InChI | InChI=1S/C13H24F2N2.C2H6/c1-4-16-7-5-12(6-8-16)9-17(11(2)3)10-13(12,14)15;1-2/h11H,4-10H2,1-3H3;1-2H3 |
| InChIKey | YJFCAGPSOUEKIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane?
The IUPAC name of ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane (CID 176558189) is ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane.
What is the SMILES notation for ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane?
The canonical SMILES for ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane is CC.CCN1CCC2(CC1)CN(C(C)C)CC2(F)F.
What is the InChIKey of ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane?
The InChIKey is YJFCAGPSOUEKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2N2.C2H6/c1-4-16-7-5-12(6-8-16)9-17(11(2)3)10-13(12,14)15;1-2/h11H,4-10H2,1-3H3;1-2H3.
What are the key properties of ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane?
ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane has a molecular weight of 276.41 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-ethyl-4,4-difluoro-2-propan-2-yl-2,8-diazaspiro[4.5]decane is sourced from PubChem (CID 176558189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).