About 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one
3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one (PubChem CID 176558249) has the molecular formula C23H45F2N3O
and a molecular weight of 417.63 g/mol. Its IUPAC name is 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one |
| PubChem CID | 176558249 |
| Molecular Formula | C23H45F2N3O |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.35 |
| IUPAC Name | 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one |
| SMILES | CC.CCC(=O)N1CCC(C2CCNCC2)CC1.CCCN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H24N2O.C8H15F2N.C2H6/c1-2-13(16)15-9-5-12(6-10-15)11-3-7-14-8-4-11;1-2-5-11-6-3-4-8(9,10)7-11;1-2/h11-12,14H,2-10H2,1H3;2-7H2,1H3;1-2H3 |
| InChIKey | JJPXWRRMDWNRRY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one?
The IUPAC name of 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one (CID 176558249) is 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one.
What is the SMILES notation for 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one?
The canonical SMILES for 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one is CC.CCC(=O)N1CCC(C2CCNCC2)CC1.CCCN1CCCC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one?
The InChIKey is JJPXWRRMDWNRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O.C8H15F2N.C2H6/c1-2-13(16)15-9-5-12(6-10-15)11-3-7-14-8-4-11;1-2-5-11-6-3-4-8(9,10)7-11;1-2/h11-12,14H,2-10H2,1H3;2-7H2,1H3;1-2H3.
What are the key properties of 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one?
3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one has a molecular weight of 417.63 g/mol, XLogP of 4.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-propylpiperidine;ethane;1-(4-piperidin-4-ylpiperidin-1-yl)propan-1-one is sourced from PubChem (CID 176558249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).