About 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane
3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (PubChem CID 176558300) has the molecular formula C21H41F2N3
and a molecular weight of 373.58 g/mol. Its IUPAC name is 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| PubChem CID | 176558300 |
| Molecular Formula | C21H41F2N3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane |
| SMILES | CC(C)CN1CCCC(F)(F)C1.CC(C)N1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/C12H24N2.C9H17F2N/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-8(2)6-12-5-3-4-9(10,11)7-12/h11,13H,3-10H2,1-2H3;8H,3-7H2,1-2H3 |
| InChIKey | PNYQLCVBGCFETE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The IUPAC name of 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane (CID 176558300) is 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The canonical SMILES for 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is CC(C)CN1CCCC(F)(F)C1.CC(C)N1CCC2(CCNCC2)CC1.
What is the InChIKey of 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
The InChIKey is PNYQLCVBGCFETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C9H17F2N/c1-11(2)14-9-5-12(6-10-14)3-7-13-8-4-12;1-8(2)6-12-5-3-4-9(10,11)7-12/h11,13H,3-10H2,1-2H3;8H,3-7H2,1-2H3.
What are the key properties of 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane?
3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane has a molecular weight of 373.58 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-(2-methylpropyl)piperidine;3-propan-2-yl-3,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 176558300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).