C15H24BNO2 — CID 176558998
(2E,3Z)-2-ethylidene-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]pyrrolidine (PubChem CID 176558998) has the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]pyrrolidine.
| Compound Name | (2E,3Z)-2-ethylidene-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]pyrrolidine |
|---|---|
| PubChem CID | 176558998 |
| Molecular Formula | C15H24BNO2 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (2E,3Z)-2-ethylidene-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]pyrrolidine |
| SMILES | C=C/C(B1OC(C)(C)C(C)(C)O1)=C1/CCN/C1=C/C |
| InChI | InChI=1S/C15H24BNO2/c1-7-12(11-9-10-17-13(11)8-2)16-18-14(3,4)15(5,6)19-16/h7-8,17H,1,9-10H2,2-6H3/b12-11+,13-8+ |
| InChIKey | AVRYWOIMJSCJFN-FYXALXGLSA-N |
| XLogP | 3.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|