C11H15F3N2O — CID 176560736
2-pentan-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 176560736) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-pentan-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-pentan-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 176560736 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-pentan-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | CCC(CC)c1ncc(CC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15F3N2O/c1-3-7(4-2)9-15-6-8(10(17)16-9)5-11(12,13)14/h6-7H,3-5H2,1-2H3,(H,15,16,17) |
| InChIKey | CVRRGOYTMMSMAW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |