C21H26FN4O+ — CID 176560739
3-ethyl-6-[(1R)-3-[4-(5-fluoro-2-pyridinyl)piperazin-1-ium-1-ylidene]cyclopentyl]-1H-pyridin-2-one (PubChem CID 176560739) has the molecular formula C21H26FN4O+ and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-ethyl-6-[(1R)-3-[4-(5-fluoro-2-pyridinyl)piperazin-1-ium-1-ylidene]cyclopentyl]-1H-pyridin-2-one.
| Compound Name | 3-ethyl-6-[(1R)-3-[4-(5-fluoro-2-pyridinyl)piperazin-1-ium-1-ylidene]cyclopentyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 176560739 |
| Molecular Formula | C21H26FN4O+ |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-ethyl-6-[(1R)-3-[4-(5-fluoro-2-pyridinyl)piperazin-1-ium-1-ylidene]cyclopentyl]-1H-pyridin-2-one |
| SMILES | CCc1ccc([C@@H]2CCC(=[N+]3CCN(c4ccc(F)cn4)CC3)C2)[nH]c1=O |
| InChI | InChI=1S/C21H25FN4O/c1-2-15-4-7-19(24-21(15)27)16-3-6-18(13-16)25-9-11-26(12-10-25)20-8-5-17(22)14-23-20/h4-5,7-8,14,16H,2-3,6,9-13H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | KIMGKFPGJRHBRE-MRXNPFEDSA-O |
| XLogP | 2.71 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|