C24H30N4O6 — CID 176561165
tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1a,7b-dihydrooxireno[2,3-c]isoquinolin-7-yl]-1,4-diazepane-1-carboxylate (PubChem CID 176561165) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1a,7b-dihydrooxireno[2,3-c]isoquinolin-7-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1a,7b-dihydrooxireno[2,3-c]isoquinolin-7-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 176561165 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1a,7b-dihydrooxireno[2,3-c]isoquinolin-7-yl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2cccc3c2C2OC2N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H30N4O6/c1-24(2,3)34-23(32)27-11-5-10-26(12-13-27)15-7-4-6-14-18(15)19-22(33-19)28(21(14)31)16-8-9-17(29)25-20(16)30/h4,6-7,16,19,22H,5,8-13H2,1-3H3,(H,25,29,30) |
| InChIKey | MMBIRNXOZINIPA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|