C14H24N2O — CID 176561434
(2E,4E,6E)-4-[(3R)-pyrrolidin-3-yl]oxydeca-2,4,6-trien-3-amine (PubChem CID 176561434) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E,4E,6E)-4-[(3R)-pyrrolidin-3-yl]oxydeca-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-4-[(3R)-pyrrolidin-3-yl]oxydeca-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176561434 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E,4E,6E)-4-[(3R)-pyrrolidin-3-yl]oxydeca-2,4,6-trien-3-amine |
| SMILES | C/C=C(N)\C(=C/C=C/CCC)O[C@@H]1CCNC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-5-6-7-8-14(13(15)4-2)17-12-9-10-16-11-12/h4,6-8,12,16H,3,5,9-11,15H2,1-2H3/b7-6+,13-4+,14-8+/t12-/m1/s1 |
| InChIKey | DAKWLKKHWLMNQE-AVKGTSKNSA-N |
| XLogP | 2.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|