C25H32ClN5 — CID 176561466
(2E,4E,6E)-N-[(7-chloroquinoxalin-6-yl)methyl]-4-(4,7-diazaspiro[2.5]octan-4-yl)-7-methylnona-2,4,6-trien-3-amine (PubChem CID 176561466) has the molecular formula C25H32ClN5 and a molecular weight of 438.02 g/mol. Its IUPAC name is (2E,4E,6E)-N-[(7-chloroquinoxalin-6-yl)methyl]-4-(4,7-diazaspiro[2.5]octan-4-yl)-7-methylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-N-[(7-chloroquinoxalin-6-yl)methyl]-4-(4,7-diazaspiro[2.5]octan-4-yl)-7-methylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176561466 |
| Molecular Formula | C25H32ClN5 |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (2E,4E,6E)-N-[(7-chloroquinoxalin-6-yl)methyl]-4-(4,7-diazaspiro[2.5]octan-4-yl)-7-methylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C(NCc1cc2nccnc2cc1Cl)\C(=C/C=C(\C)CC)N1CCNCC12CC2 |
| InChI | InChI=1S/C25H32ClN5/c1-4-18(3)6-7-24(31-13-12-27-17-25(31)8-9-25)21(5-2)30-16-19-14-22-23(15-20(19)26)29-11-10-28-22/h5-7,10-11,14-15,27,30H,4,8-9,12-13,16-17H2,1-3H3/b18-6+,21-5+,24-7+ |
| InChIKey | WOCSAKHIBQRZCZ-ODKXFMEMSA-N |
| XLogP | 4.95 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|