C18H29F2N3 — CID 176561560
(2E,4Z,6E)-5-(difluoromethyl)-4-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)deca-2,4,6-trien-3-amine (PubChem CID 176561560) has the molecular formula C18H29F2N3 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2E,4Z,6E)-5-(difluoromethyl)-4-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)deca-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6E)-5-(difluoromethyl)-4-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)deca-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176561560 |
| Molecular Formula | C18H29F2N3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (2E,4Z,6E)-5-(difluoromethyl)-4-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)deca-2,4,6-trien-3-amine |
| SMILES | C/C=C(N)\C(=C(/C=C/CCC)C(F)F)N1CCN(C)C2(CC2)C1 |
| InChI | InChI=1S/C18H29F2N3/c1-4-6-7-8-14(17(19)20)16(15(21)5-2)23-12-11-22(3)18(13-23)9-10-18/h5,7-8,17H,4,6,9-13,21H2,1-3H3/b8-7+,15-5+,16-14- |
| InChIKey | FREBJHHAMGHNEM-RZZGUHTRSA-N |
| XLogP | 3.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|