C20H22ClNO3 — CID 176561796
methyl 4-[(2R,6S)-4-benzyl-6-methylmorpholin-2-yl]-2-chlorobenzoate (PubChem CID 176561796) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is methyl 4-[(2R,6S)-4-benzyl-6-methylmorpholin-2-yl]-2-chlorobenzoate.
| Compound Name | methyl 4-[(2R,6S)-4-benzyl-6-methylmorpholin-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 176561796 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl 4-[(2R,6S)-4-benzyl-6-methylmorpholin-2-yl]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CN(Cc3ccccc3)C[C@H](C)O2)cc1Cl |
| InChI | InChI=1S/C20H22ClNO3/c1-14-11-22(12-15-6-4-3-5-7-15)13-19(25-14)16-8-9-17(18(21)10-16)20(23)24-2/h3-10,14,19H,11-13H2,1-2H3/t14-,19-/m0/s1 |
| InChIKey | BVLDCIFEKQWKDI-LIRRHRJNSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |