C22H26N4O4 — CID 176562386
4-[(2S,5S)-5-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid (PubChem CID 176562386) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[(2S,5S)-5-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid.
| Compound Name | 4-[(2S,5S)-5-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 176562386 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-[(2S,5S)-5-methyl-4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]morpholin-2-yl]benzoic acid |
| SMILES | C[C@H]1CO[C@@H](c2ccc(C(=O)O)cc2)CN1C(/C=C(\N)c1ccccc1O)=C(N)N |
| InChI | InChI=1S/C22H26N4O4/c1-13-12-30-20(14-6-8-15(9-7-14)22(28)29)11-26(13)18(21(24)25)10-17(23)16-4-2-3-5-19(16)27/h2-10,13,20,27H,11-12,23-25H2,1H3,(H,28,29)/b17-10-/t13-,20+/m0/s1 |
| InChIKey | LNQUYQHSTWHYGV-XIONPSMQSA-N |
| XLogP | 1.94 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|