About ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane
ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 176563261) has the molecular formula C14H29F2NO2
and a molecular weight of 281.39 g/mol. Its IUPAC name is ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane |
| PubChem CID | 176563261 |
| Molecular Formula | C14H29F2NO2 |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CC.CC.CCN1CCC2(OCCCO2)C(F)(F)C1 |
| InChI | InChI=1S/C10H17F2NO2.2C2H6/c1-2-13-5-4-10(9(11,12)8-13)14-6-3-7-15-10;2*1-2/h2-8H2,1H3;2*1-2H3 |
| InChIKey | IUDABANOMUJRIG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane?
The IUPAC name of ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane (CID 176563261) is ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane.
What is the SMILES notation for ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane?
The canonical SMILES for ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane is CC.CC.CCN1CCC2(OCCCO2)C(F)(F)C1.
What is the InChIKey of ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane?
The InChIKey is IUDABANOMUJRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2.2C2H6/c1-2-13-5-4-10(9(11,12)8-13)14-6-3-7-15-10;2*1-2/h2-8H2,1H3;2*1-2H3.
What are the key properties of ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane?
ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane has a molecular weight of 281.39 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-ethyl-11,11-difluoro-1,5-dioxa-9-azaspiro[5.5]undecane is sourced from PubChem (CID 176563261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).