About 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane
11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 176563569) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| PubChem CID | 176563569 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CN1CCC2(OCCCO2)C(F)(F)C1 |
| InChI | InChI=1S/C9H15F2NO2/c1-12-4-3-9(8(10,11)7-12)13-5-2-6-14-9/h2-7H2,1H3 |
| InChIKey | CILIDHZHUGFYIB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane?
The IUPAC name of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane (CID 176563569) is 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane.
What is the SMILES notation for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane?
The canonical SMILES for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane is CN1CCC2(OCCCO2)C(F)(F)C1.
What is the InChIKey of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane?
The InChIKey is CILIDHZHUGFYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-12-4-3-9(8(10,11)7-12)13-5-2-6-14-9/h2-7H2,1H3.
What are the key properties of 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane?
11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane has a molecular weight of 207.22 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11,11-difluoro-9-methyl-1,5-dioxa-9-azaspiro[5.5]undecane is sourced from PubChem (CID 176563569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).